C15H30N2O — CID 55152195
N-methyl-2-(1,4-oxazepan-4-yl)-4-propylcyclohexan-1-amine (PubChem CID 55152195) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is N-methyl-2-(1,4-oxazepan-4-yl)-4-propylcyclohexan-1-amine.
| Compound Name | N-methyl-2-(1,4-oxazepan-4-yl)-4-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 55152195 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | N-methyl-2-(1,4-oxazepan-4-yl)-4-propylcyclohexan-1-amine |
| SMILES | CCCC1CCC(NC)C(N2CCCOCC2)C1 |
| InChI | InChI=1S/C15H30N2O/c1-3-5-13-6-7-14(16-2)15(12-13)17-8-4-10-18-11-9-17/h13-16H,3-12H2,1-2H3 |
| InChIKey | MXGIGVPIZCCNIW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |