C12H6BrF3N2O — CID 55152694
5-bromo-N-(3,4,5-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 55152694) has the molecular formula C12H6BrF3N2O and a molecular weight of 331.09 g/mol. Its IUPAC name is 5-bromo-N-(3,4,5-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-(3,4,5-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55152694 |
| Molecular Formula | C12H6BrF3N2O |
| Molecular Weight | 331.09 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 5-bromo-N-(3,4,5-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Br)cn1 |
| InChI | InChI=1S/C12H6BrF3N2O/c13-6-1-2-10(17-5-6)12(19)18-7-3-8(14)11(16)9(15)4-7/h1-5H,(H,18,19) |
| InChIKey | BYFPLEASCXHHBO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.09 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|