About 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide
2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide (PubChem CID 55152771) has the molecular formula C14H19N3OS
and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide.
Molecular Properties
| Compound Name | 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
| PubChem CID | 55152771 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
| SMILES | NC(=S)c1cc2c(nc1N1CCCOCC1)CCC2 |
| InChI | InChI=1S/C14H19N3OS/c15-13(19)11-9-10-3-1-4-12(10)16-14(11)17-5-2-7-18-8-6-17/h9H,1-8H2,(H2,15,19) |
| InChIKey | LDPHVJARCJAEHP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide?
The IUPAC name of 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide (CID 55152771) is 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide.
What is the SMILES notation for 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide?
The canonical SMILES for 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide is NC(=S)c1cc2c(nc1N1CCCOCC1)CCC2.
What is the InChIKey of 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide?
The InChIKey is LDPHVJARCJAEHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3OS/c15-13(19)11-9-10-3-1-4-12(10)16-14(11)17-5-2-7-18-8-6-17/h9H,1-8H2,(H2,15,19).
What are the key properties of 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide?
2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide has a molecular weight of 277.39 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-oxazepan-4-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide is sourced from PubChem (CID 55152771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).