C11H7ClN4S — CID 55152978
4-(3-chlorophenyl)-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole (PubChem CID 55152978) has the molecular formula C11H7ClN4S and a molecular weight of 262.73 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole.
| Compound Name | 4-(3-chlorophenyl)-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 55152978 |
| Molecular Formula | C11H7ClN4S |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 4-(3-chlorophenyl)-2-(1H-1,2,4-triazol-5-yl)-1,3-thiazole |
| SMILES | Clc1cccc(-c2csc(-c3ncn[nH]3)n2)c1 |
| InChI | InChI=1S/C11H7ClN4S/c12-8-3-1-2-7(4-8)9-5-17-11(15-9)10-13-6-14-16-10/h1-6H,(H,13,14,16) |
| InChIKey | XKYCOTPZSXHVNI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |