About (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine
(1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine (PubChem CID 55153163) has the molecular formula C11H10N6
and a molecular weight of 226.24 g/mol. Its IUPAC name is (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine.
Molecular Properties
| Compound Name | (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine |
| PubChem CID | 55153163 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine |
| SMILES | NCc1ncn(-c2nncc3ccccc23)n1 |
| InChI | InChI=1S/C11H10N6/c12-5-10-13-7-17(16-10)11-9-4-2-1-3-8(9)6-14-15-11/h1-4,6-7H,5,12H2 |
| InChIKey | MLUURTWHSJPYOK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine?
The IUPAC name of (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine (CID 55153163) is (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine.
What is the SMILES notation for (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine?
The canonical SMILES for (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine is NCc1ncn(-c2nncc3ccccc23)n1.
What is the InChIKey of (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine?
The InChIKey is MLUURTWHSJPYOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6/c12-5-10-13-7-17(16-10)11-9-4-2-1-3-8(9)6-14-15-11/h1-4,6-7H,5,12H2.
What are the key properties of (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine?
(1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine has a molecular weight of 226.24 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phthalazin-1-yl-1,2,4-triazol-3-yl)methanamine is sourced from PubChem (CID 55153163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).