C12H20N2O3 — CID 55153337
1-[2-(1,4-oxazepan-4-yl)acetyl]piperidin-4-one (PubChem CID 55153337) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-[2-(1,4-oxazepan-4-yl)acetyl]piperidin-4-one.
| Compound Name | 1-[2-(1,4-oxazepan-4-yl)acetyl]piperidin-4-one |
|---|---|
| PubChem CID | 55153337 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-[2-(1,4-oxazepan-4-yl)acetyl]piperidin-4-one |
| SMILES | O=C1CCN(C(=O)CN2CCCOCC2)CC1 |
| InChI | InChI=1S/C12H20N2O3/c15-11-2-5-14(6-3-11)12(16)10-13-4-1-8-17-9-7-13/h1-10H2 |
| InChIKey | PQNBJGSYBPTBNZ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |