About 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea
1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 55153362) has the molecular formula C10H8F3N5O
and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| PubChem CID | 55153362 |
| Molecular Formula | C10H8F3N5O |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C10H8F3N5O/c11-10(12,13)6-1-3-7(4-2-6)16-9(19)17-8-14-5-15-18-8/h1-5H,(H3,14,15,16,17,18,19) |
| InChIKey | OPMGJHXEWFHDHI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea (CID 55153362) is 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea is O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ncn[nH]1.
What is the InChIKey of 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea?
The InChIKey is OPMGJHXEWFHDHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N5O/c11-10(12,13)6-1-3-7(4-2-6)16-9(19)17-8-14-5-15-18-8/h1-5H,(H3,14,15,16,17,18,19).
What are the key properties of 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea?
1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea has a molecular weight of 271.20 g/mol, XLogP of 2.47, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 55153362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).