C15H22N2 — CID 55153862
2-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]cyclopentane-1-carbonitrile (PubChem CID 55153862) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]cyclopentane-1-carbonitrile.
| Compound Name | 2-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 55153862 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]cyclopentane-1-carbonitrile |
| SMILES | CC(NC1CCCC1C#N)C1CC2C=CC1C2 |
| InChI | InChI=1S/C15H22N2/c1-10(14-8-11-5-6-12(14)7-11)17-15-4-2-3-13(15)9-16/h5-6,10-15,17H,2-4,7-8H2,1H3 |
| InChIKey | YGCZNCYOEMAVFM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|