C13H13N5 — CID 55154565
2-methyl-3-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)aniline (PubChem CID 55154565) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-methyl-3-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)aniline.
| Compound Name | 2-methyl-3-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)aniline |
|---|---|
| PubChem CID | 55154565 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-methyl-3-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)aniline |
| SMILES | Cc1ccc2nnc(-c3cccc(N)c3C)n2n1 |
| InChI | InChI=1S/C13H13N5/c1-8-6-7-12-15-16-13(18(12)17-8)10-4-3-5-11(14)9(10)2/h3-7H,14H2,1-2H3 |
| InChIKey | IYEXPKFOKXKJFA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|