C13H14BrN3O2 — CID 55155667
1-[2-(2-bromoanilino)ethyl]-4-methylpyrazine-2,3-dione (PubChem CID 55155667) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 1-[2-(2-bromoanilino)ethyl]-4-methylpyrazine-2,3-dione.
| Compound Name | 1-[2-(2-bromoanilino)ethyl]-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 55155667 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-[2-(2-bromoanilino)ethyl]-4-methylpyrazine-2,3-dione |
| SMILES | Cn1ccn(CCNc2ccccc2Br)c(=O)c1=O |
| InChI | InChI=1S/C13H14BrN3O2/c1-16-8-9-17(13(19)12(16)18)7-6-15-11-5-3-2-4-10(11)14/h2-5,8-9,15H,6-7H2,1H3 |
| InChIKey | GXTFMRNZYUYDHU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|