C13H14ClN3O — CID 55156230
3-[(3-chlorophenyl)methylamino]-1-ethylpyrazin-2-one (PubChem CID 55156230) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylamino]-1-ethylpyrazin-2-one.
| Compound Name | 3-[(3-chlorophenyl)methylamino]-1-ethylpyrazin-2-one |
|---|---|
| PubChem CID | 55156230 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-[(3-chlorophenyl)methylamino]-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(NCc2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C13H14ClN3O/c1-2-17-7-6-15-12(13(17)18)16-9-10-4-3-5-11(14)8-10/h3-8H,2,9H2,1H3,(H,15,16) |
| InChIKey | FJBLJIXNAGEZBK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |