C13H24N4O — CID 55156305
2-[2-(pentan-2-ylamino)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 55156305) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[2-(pentan-2-ylamino)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-(pentan-2-ylamino)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 55156305 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-[2-(pentan-2-ylamino)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCCC(C)NCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C13H24N4O/c1-3-6-11(2)14-8-10-17-13(18)16-9-5-4-7-12(16)15-17/h11,14H,3-10H2,1-2H3 |
| InChIKey | TWHQRSAACNOXTI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |