C14H26N2OS — CID 55156590
1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine (PubChem CID 55156590) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 55156590 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine |
| SMILES | COCCNC(CC(C)(C)C)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C14H26N2OS/c1-10-11(2)18-13(16-10)12(9-14(3,4)5)15-7-8-17-6/h12,15H,7-9H2,1-6H3 |
| InChIKey | AMYWKUIOQHZHHJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|