C11H25N3O2S — CID 55156700
N-(3-aminopropyl)-N,4,4-trimethylpiperidine-1-sulfonamide (PubChem CID 55156700) has the molecular formula C11H25N3O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-(3-aminopropyl)-N,4,4-trimethylpiperidine-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-N,4,4-trimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 55156700 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(3-aminopropyl)-N,4,4-trimethylpiperidine-1-sulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C11H25N3O2S/c1-11(2)5-9-14(10-6-11)17(15,16)13(3)8-4-7-12/h4-10,12H2,1-3H3 |
| InChIKey | GQFVYGODWYKKIO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |