About 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one (PubChem CID 55157767) has the molecular formula C12H15BrN4O
and a molecular weight of 311.18 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one |
| PubChem CID | 55157767 |
| Molecular Formula | C12H15BrN4O |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one |
| SMILES | CCCn1ccnc(-n2nc(C)c(Br)c2C)c1=O |
| InChI | InChI=1S/C12H15BrN4O/c1-4-6-16-7-5-14-11(12(16)18)17-9(3)10(13)8(2)15-17/h5,7H,4,6H2,1-3H3 |
| InChIKey | LEKLJUOMVROJMJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one?
The IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one (CID 55157767) is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one.
What is the SMILES notation for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one?
The canonical SMILES for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one is CCCn1ccnc(-n2nc(C)c(Br)c2C)c1=O.
What is the InChIKey of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one?
The InChIKey is LEKLJUOMVROJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN4O/c1-4-6-16-7-5-14-11(12(16)18)17-9(3)10(13)8(2)15-17/h5,7H,4,6H2,1-3H3.
What are the key properties of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one?
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one has a molecular weight of 311.18 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-1-propylpyrazin-2-one is sourced from PubChem (CID 55157767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).