C14H14N2S — CID 55158039
6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl(phenyl)methanimine (PubChem CID 55158039) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl(phenyl)methanimine.
| Compound Name | 6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl(phenyl)methanimine |
|---|---|
| PubChem CID | 55158039 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl(phenyl)methanimine |
| SMILES | [H]/N=C(\c1ccccc1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C14H14N2S/c15-14(11-4-2-1-3-5-11)16-8-6-13-12(10-16)7-9-17-13/h1-5,7,9,15H,6,8,10H2/b15-14+ |
| InChIKey | VZQBLXHLRJBNLX-CCEZHUSRSA-N |
| XLogP | 3.13 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|