C13H25N3O2 — CID 55158561
methyl 2-(cyclopropylamino)-3-[3-(dimethylamino)pyrrolidin-1-yl]propanoate (PubChem CID 55158561) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is methyl 2-(cyclopropylamino)-3-[3-(dimethylamino)pyrrolidin-1-yl]propanoate.
| Compound Name | methyl 2-(cyclopropylamino)-3-[3-(dimethylamino)pyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 55158561 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | methyl 2-(cyclopropylamino)-3-[3-(dimethylamino)pyrrolidin-1-yl]propanoate |
| SMILES | COC(=O)C(CN1CCC(N(C)C)C1)NC1CC1 |
| InChI | InChI=1S/C13H25N3O2/c1-15(2)11-6-7-16(8-11)9-12(13(17)18-3)14-10-4-5-10/h10-12,14H,4-9H2,1-3H3 |
| InChIKey | YZUVKFBIAGBNPR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |