C13H28N4O — CID 55158563
3-[3-(diethylamino)pyrrolidin-1-yl]-2-methyl-2-(methylamino)propanamide (PubChem CID 55158563) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-[3-(diethylamino)pyrrolidin-1-yl]-2-methyl-2-(methylamino)propanamide.
| Compound Name | 3-[3-(diethylamino)pyrrolidin-1-yl]-2-methyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 55158563 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | 3-[3-(diethylamino)pyrrolidin-1-yl]-2-methyl-2-(methylamino)propanamide |
| SMILES | CCN(CC)C1CCN(CC(C)(NC)C(N)=O)C1 |
| InChI | InChI=1S/C13H28N4O/c1-5-17(6-2)11-7-8-16(9-11)10-13(3,15-4)12(14)18/h11,15H,5-10H2,1-4H3,(H2,14,18) |
| InChIKey | GHTTZLGLZLATGK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |