About N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide
N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide (PubChem CID 55158726) has the molecular formula C16H31N3
and a molecular weight of 265.44 g/mol. Its IUPAC name is N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide |
| PubChem CID | 55158726 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide |
| SMILES | CCC1(CC)CCN(/C(N)=N/C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H31N3/c1-3-16(4-2)10-12-19(13-11-16)15(17)18-14-8-6-5-7-9-14/h14H,3-13H2,1-2H3,(H2,17,18) |
| InChIKey | QIEQNHZEMMEFBM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide?
The IUPAC name of N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide (CID 55158726) is N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide.
What is the SMILES notation for N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide?
The canonical SMILES for N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide is CCC1(CC)CCN(/C(N)=N/C2CCCCC2)CC1.
What is the InChIKey of N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide?
The InChIKey is QIEQNHZEMMEFBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3/c1-3-16(4-2)10-12-19(13-11-16)15(17)18-14-8-6-5-7-9-14/h14H,3-13H2,1-2H3,(H2,17,18).
What are the key properties of N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide?
N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide has a molecular weight of 265.44 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclohexyl-4,4-diethylpiperidine-1-carboximidamide is sourced from PubChem (CID 55158726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).