C13H19FN2O — CID 55159271
2-fluoro-4-[[2-(oxolan-2-yl)ethylamino]methyl]aniline (PubChem CID 55159271) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-fluoro-4-[[2-(oxolan-2-yl)ethylamino]methyl]aniline.
| Compound Name | 2-fluoro-4-[[2-(oxolan-2-yl)ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 55159271 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-fluoro-4-[[2-(oxolan-2-yl)ethylamino]methyl]aniline |
| SMILES | Nc1ccc(CNCCC2CCCO2)cc1F |
| InChI | InChI=1S/C13H19FN2O/c14-12-8-10(3-4-13(12)15)9-16-6-5-11-2-1-7-17-11/h3-4,8,11,16H,1-2,5-7,9,15H2 |
| InChIKey | KFYRHEIEQYLGLK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|