C11H7F3N2O — CID 55160397
2-(1H-imidazol-2-yl)-1-(3,4,5-trifluorophenyl)ethanone (PubChem CID 55160397) has the molecular formula C11H7F3N2O and a molecular weight of 240.18 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-1-(3,4,5-trifluorophenyl)ethanone.
| Compound Name | 2-(1H-imidazol-2-yl)-1-(3,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 55160397 |
| Molecular Formula | C11H7F3N2O |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-1-(3,4,5-trifluorophenyl)ethanone |
| SMILES | O=C(Cc1ncc[nH]1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H7F3N2O/c12-7-3-6(4-8(13)11(7)14)9(17)5-10-15-1-2-16-10/h1-4H,5H2,(H,15,16) |
| InChIKey | OCGOHHUYQVGIOC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|