C14H15N3O — CID 55160748
N'-[(6-methoxy-3-pyridinyl)methyl]benzenecarboximidamide (PubChem CID 55160748) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is N'-[(6-methoxy-3-pyridinyl)methyl]benzenecarboximidamide.
| Compound Name | N'-[(6-methoxy-3-pyridinyl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 55160748 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N'-[(6-methoxy-3-pyridinyl)methyl]benzenecarboximidamide |
| SMILES | COc1ccc(C/N=C(\N)c2ccccc2)cn1 |
| InChI | InChI=1S/C14H15N3O/c1-18-13-8-7-11(9-16-13)10-17-14(15)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H2,15,17) |
| InChIKey | KWQMYEQMHQWZOZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|