About 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide
6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide (PubChem CID 55163586) has the molecular formula C11H17ClN2O2S
and a molecular weight of 276.79 g/mol. Its IUPAC name is 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide |
| PubChem CID | 55163586 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide |
| SMILES | CC(C)(C)C(Cl)Cc1ccc(S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C11H17ClN2O2S/c1-11(2,3)10(12)6-8-4-5-9(7-14-8)17(13,15)16/h4-5,7,10H,6H2,1-3H3,(H2,13,15,16) |
| InChIKey | PWKNPCNLWPLFKS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide?
The IUPAC name of 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide (CID 55163586) is 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide.
What is the SMILES notation for 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide?
The canonical SMILES for 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide is CC(C)(C)C(Cl)Cc1ccc(S(N)(=O)=O)cn1.
What is the InChIKey of 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide?
The InChIKey is PWKNPCNLWPLFKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2O2S/c1-11(2,3)10(12)6-8-4-5-9(7-14-8)17(13,15)16/h4-5,7,10H,6H2,1-3H3,(H2,13,15,16).
What are the key properties of 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide?
6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide has a molecular weight of 276.79 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chloro-3,3-dimethylbutyl)pyridine-3-sulfonamide is sourced from PubChem (CID 55163586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).