C14H24N2O2S — CID 55163915
5-methylsulfonyl-N-propyl-1-pyridin-4-ylpentan-2-amine (PubChem CID 55163915) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is 5-methylsulfonyl-N-propyl-1-pyridin-4-ylpentan-2-amine.
| Compound Name | 5-methylsulfonyl-N-propyl-1-pyridin-4-ylpentan-2-amine |
|---|---|
| PubChem CID | 55163915 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-methylsulfonyl-N-propyl-1-pyridin-4-ylpentan-2-amine |
| SMILES | CCCNC(CCCS(C)(=O)=O)Cc1ccncc1 |
| InChI | InChI=1S/C14H24N2O2S/c1-3-8-16-14(5-4-11-19(2,17)18)12-13-6-9-15-10-7-13/h6-7,9-10,14,16H,3-5,8,11-12H2,1-2H3 |
| InChIKey | YMVGGXYFMVIZDV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |