C13H17N3O3 — CID 55166012
5-[[cyclobutylmethyl(methyl)carbamoyl]amino]pyridine-3-carboxylic acid (PubChem CID 55166012) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-[[cyclobutylmethyl(methyl)carbamoyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 5-[[cyclobutylmethyl(methyl)carbamoyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 55166012 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5-[[cyclobutylmethyl(methyl)carbamoyl]amino]pyridine-3-carboxylic acid |
| SMILES | CN(CC1CCC1)C(=O)Nc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C13H17N3O3/c1-16(8-9-3-2-4-9)13(19)15-11-5-10(12(17)18)6-14-7-11/h5-7,9H,2-4,8H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | USICCRNWMMXXAG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |