C6H12N4O2S — CID 551666
N,N-diethyl-1H-1,2,4-triazole-5-sulfonamide (PubChem CID 551666) has the molecular formula C6H12N4O2S and a molecular weight of 204.25 g/mol. Its IUPAC name is N,N-diethyl-1H-1,2,4-triazole-5-sulfonamide.
| Compound Name | N,N-diethyl-1H-1,2,4-triazole-5-sulfonamide |
|---|---|
| PubChem CID | 551666 |
| Molecular Formula | C6H12N4O2S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | N,N-diethyl-1H-1,2,4-triazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C6H12N4O2S/c1-3-10(4-2)13(11,12)6-7-5-8-9-6/h5H,3-4H2,1-2H3,(H,7,8,9) |
| InChIKey | VLGZTOGABYNHMH-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |