C16H25N3 — CID 55166762
2-(2-piperazin-1-ylethyl)-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 55166762) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-(2-piperazin-1-ylethyl)-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 2-(2-piperazin-1-ylethyl)-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 55166762 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-(2-piperazin-1-ylethyl)-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | c1ccc2c(c1)CCCN(CCN1CCNCC1)C2 |
| InChI | InChI=1S/C16H25N3/c1-2-5-16-14-19(9-3-6-15(16)4-1)13-12-18-10-7-17-8-11-18/h1-2,4-5,17H,3,6-14H2 |
| InChIKey | ADLJBMFWJUHGHX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |