About 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide
3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide (PubChem CID 55167066) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide |
| PubChem CID | 55167066 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide |
| SMILES | CCC1(C(=O)NC(C)(C)CC(C)(C)C)CCNC1 |
| InChI | InChI=1S/C15H30N2O/c1-7-15(8-9-16-11-15)12(18)17-14(5,6)10-13(2,3)4/h16H,7-11H2,1-6H3,(H,17,18) |
| InChIKey | FULYSYAFSJZILI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide?
The IUPAC name of 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide (CID 55167066) is 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide.
What is the SMILES notation for 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide?
The canonical SMILES for 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide is CCC1(C(=O)NC(C)(C)CC(C)(C)C)CCNC1.
What is the InChIKey of 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide?
The InChIKey is FULYSYAFSJZILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O/c1-7-15(8-9-16-11-15)12(18)17-14(5,6)10-13(2,3)4/h16H,7-11H2,1-6H3,(H,17,18).
What are the key properties of 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide?
3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide has a molecular weight of 254.42 g/mol, XLogP of 2.71, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxamide is sourced from PubChem (CID 55167066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).