C8H11N3O5S — CID 55167275
3-(2-methoxyethylsulfonylamino)pyrazine-2-carboxylic acid (PubChem CID 55167275) has the molecular formula C8H11N3O5S and a molecular weight of 261.26 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfonylamino)pyrazine-2-carboxylic acid.
| Compound Name | 3-(2-methoxyethylsulfonylamino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 55167275 |
| Molecular Formula | C8H11N3O5S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 3-(2-methoxyethylsulfonylamino)pyrazine-2-carboxylic acid |
| SMILES | COCCS(=O)(=O)Nc1nccnc1C(=O)O |
| InChI | InChI=1S/C8H11N3O5S/c1-16-4-5-17(14,15)11-7-6(8(12)13)9-2-3-10-7/h2-3H,4-5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | LQDCPPKHMIHSGJ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |