About propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate
propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate (PubChem CID 55168531) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate |
| PubChem CID | 55168531 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate |
| SMILES | Cc1c(C)c(=O)n(CC(=O)OC(C)C)[nH]c1=O |
| InChI | InChI=1S/C11H16N2O4/c1-6(2)17-9(14)5-13-11(16)8(4)7(3)10(15)12-13/h6H,5H2,1-4H3,(H,12,15) |
| InChIKey | NDUOUNFDTSPHKF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate?
The IUPAC name of propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate (CID 55168531) is propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate.
What is the SMILES notation for propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate?
The canonical SMILES for propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate is Cc1c(C)c(=O)n(CC(=O)OC(C)C)[nH]c1=O.
What is the InChIKey of propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate?
The InChIKey is NDUOUNFDTSPHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-6(2)17-9(14)5-13-11(16)8(4)7(3)10(15)12-13/h6H,5H2,1-4H3,(H,12,15).
What are the key properties of propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate?
propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate has a molecular weight of 240.26 g/mol, XLogP of 0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetate is sourced from PubChem (CID 55168531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).