C15H12F2O2 — CID 55169275
2-(2,5-difluorophenoxy)-1-(2-methylphenyl)ethanone (PubChem CID 55169275) has the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. Its IUPAC name is 2-(2,5-difluorophenoxy)-1-(2-methylphenyl)ethanone.
| Compound Name | 2-(2,5-difluorophenoxy)-1-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 55169275 |
| Molecular Formula | C15H12F2O2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(2,5-difluorophenoxy)-1-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1C(=O)COc1cc(F)ccc1F |
| InChI | InChI=1S/C15H12F2O2/c1-10-4-2-3-5-12(10)14(18)9-19-15-8-11(16)6-7-13(15)17/h2-8H,9H2,1H3 |
| InChIKey | YCFSOQJHKRRDSL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |