C12H10ClF2N3 — CID 55169285
6-chloro-N-(3,5-difluorophenyl)-4,5-dimethylpyridazin-3-amine (PubChem CID 55169285) has the molecular formula C12H10ClF2N3 and a molecular weight of 269.68 g/mol. Its IUPAC name is 6-chloro-N-(3,5-difluorophenyl)-4,5-dimethylpyridazin-3-amine.
| Compound Name | 6-chloro-N-(3,5-difluorophenyl)-4,5-dimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 55169285 |
| Molecular Formula | C12H10ClF2N3 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 6-chloro-N-(3,5-difluorophenyl)-4,5-dimethylpyridazin-3-amine |
| SMILES | Cc1c(Cl)nnc(Nc2cc(F)cc(F)c2)c1C |
| InChI | InChI=1S/C12H10ClF2N3/c1-6-7(2)12(18-17-11(6)13)16-10-4-8(14)3-9(15)5-10/h3-5H,1-2H3,(H,16,18) |
| InChIKey | WPVZLLYNMZCOLU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |