About 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol
4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol (PubChem CID 55169291) has the molecular formula C12H18ClN3O
and a molecular weight of 255.75 g/mol. Its IUPAC name is 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol |
| PubChem CID | 55169291 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol |
| SMILES | Cc1c(Cl)nnc(NC2CCC(O)CC2)c1C |
| InChI | InChI=1S/C12H18ClN3O/c1-7-8(2)12(16-15-11(7)13)14-9-3-5-10(17)6-4-9/h9-10,17H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | ICMOBDANNNFLPD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol?
The IUPAC name of 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol (CID 55169291) is 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol?
The canonical SMILES for 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol is Cc1c(Cl)nnc(NC2CCC(O)CC2)c1C.
What is the InChIKey of 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol?
The InChIKey is ICMOBDANNNFLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3O/c1-7-8(2)12(16-15-11(7)13)14-9-3-5-10(17)6-4-9/h9-10,17H,3-6H2,1-2H3,(H,14,16).
What are the key properties of 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol?
4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol has a molecular weight of 255.75 g/mol, XLogP of 2.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]cyclohexan-1-ol is sourced from PubChem (CID 55169291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).