C12H18N4O3 — CID 55169502
N-(2-methoxyethyl)-2-(3-oxo-5,6,7,8-tetrahydropyrido[4,3-c]pyridazin-2-yl)acetamide (PubChem CID 55169502) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(3-oxo-5,6,7,8-tetrahydropyrido[4,3-c]pyridazin-2-yl)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(3-oxo-5,6,7,8-tetrahydropyrido[4,3-c]pyridazin-2-yl)acetamide |
|---|---|
| PubChem CID | 55169502 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-(2-methoxyethyl)-2-(3-oxo-5,6,7,8-tetrahydropyrido[4,3-c]pyridazin-2-yl)acetamide |
| SMILES | COCCNC(=O)Cn1nc2c(cc1=O)CNCC2 |
| InChI | InChI=1S/C12H18N4O3/c1-19-5-4-14-11(17)8-16-12(18)6-9-7-13-3-2-10(9)15-16/h6,13H,2-5,7-8H2,1H3,(H,14,17) |
| InChIKey | WWGKPYLPWLWXGO-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|