C11H12F5NO — CID 55171742
[5-fluoro-2-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanamine (PubChem CID 55171742) has the molecular formula C11H12F5NO and a molecular weight of 269.21 g/mol. Its IUPAC name is [5-fluoro-2-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanamine.
| Compound Name | [5-fluoro-2-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 55171742 |
| Molecular Formula | C11H12F5NO |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [5-fluoro-2-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanamine |
| SMILES | NCc1cc(F)ccc1COCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H12F5NO/c12-9-2-1-7(8(3-9)4-17)5-18-6-11(15,16)10(13)14/h1-3,10H,4-6,17H2 |
| InChIKey | ULGPZCMCEASFJU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|