About 1,3-dimethoxycyclopentane
1,3-dimethoxycyclopentane (PubChem CID 551718) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 1,3-dimethoxycyclopentane.
Molecular Properties
| Compound Name | 1,3-dimethoxycyclopentane |
| PubChem CID | 551718 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 1,3-dimethoxycyclopentane |
| SMILES | COC1CCC(OC)C1 |
| InChI | InChI=1S/C7H14O2/c1-8-6-3-4-7(5-6)9-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | QBRPYJDRWAUJGP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethoxycyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethoxycyclopentane?
The IUPAC name of 1,3-dimethoxycyclopentane (CID 551718) is 1,3-dimethoxycyclopentane.
What is the SMILES notation for 1,3-dimethoxycyclopentane?
The canonical SMILES for 1,3-dimethoxycyclopentane is COC1CCC(OC)C1.
What is the InChIKey of 1,3-dimethoxycyclopentane?
The InChIKey is QBRPYJDRWAUJGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-8-6-3-4-7(5-6)9-2/h6-7H,3-5H2,1-2H3.
What are the key properties of 1,3-dimethoxycyclopentane?
1,3-dimethoxycyclopentane has a molecular weight of 130.19 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethoxycyclopentane is sourced from PubChem (CID 551718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).