About N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide
N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide (PubChem CID 55172737) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide |
| PubChem CID | 55172737 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC(O)C2CC2)c1 |
| InChI | InChI=1S/C14H19NO2/c1-9-5-10(2)7-12(6-9)14(17)15-8-13(16)11-3-4-11/h5-7,11,13,16H,3-4,8H2,1-2H3,(H,15,17) |
| InChIKey | VQZYJNMJDZEISV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide?
The IUPAC name of N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide (CID 55172737) is N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide.
What is the SMILES notation for N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide?
The canonical SMILES for N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide is Cc1cc(C)cc(C(=O)NCC(O)C2CC2)c1.
What is the InChIKey of N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide?
The InChIKey is VQZYJNMJDZEISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-9-5-10(2)7-12(6-9)14(17)15-8-13(16)11-3-4-11/h5-7,11,13,16H,3-4,8H2,1-2H3,(H,15,17).
What are the key properties of N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide?
N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide has a molecular weight of 233.31 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclopropyl-2-hydroxyethyl)-3,5-dimethylbenzamide is sourced from PubChem (CID 55172737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).