C11H14F3N3S — CID 55173396
N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 55173396) has the molecular formula C11H14F3N3S and a molecular weight of 277.31 g/mol. Its IUPAC name is N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 55173396 |
| Molecular Formula | C11H14F3N3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | Cc1nc2scc(C)n2c1CNCCC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3S/c1-7-6-18-10-16-8(2)9(17(7)10)5-15-4-3-11(12,13)14/h6,15H,3-5H2,1-2H3 |
| InChIKey | NMBPPRGCTCYBNQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|