C15H20ClN3 — CID 55173458
4-chloro-2-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]benzonitrile (PubChem CID 55173458) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is 4-chloro-2-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]benzonitrile.
| Compound Name | 4-chloro-2-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 55173458 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 4-chloro-2-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]benzonitrile |
| SMILES | CN1CCC(CN(C)c2cc(Cl)ccc2C#N)CC1 |
| InChI | InChI=1S/C15H20ClN3/c1-18-7-5-12(6-8-18)11-19(2)15-9-14(16)4-3-13(15)10-17/h3-4,9,12H,5-8,11H2,1-2H3 |
| InChIKey | VTFMABFYOVASKR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |