About N,2-dimethylpentan-3-amine
N,2-dimethylpentan-3-amine (PubChem CID 551737) has the molecular formula C7H17N
and a molecular weight of 115.22 g/mol. Its IUPAC name is N,2-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | N,2-dimethylpentan-3-amine |
| PubChem CID | 551737 |
| Molecular Formula | C7H17N |
| Molecular Weight | 115.22 g/mol |
| Exact Mass | 115.14 |
| IUPAC Name | N,2-dimethylpentan-3-amine |
| SMILES | CCC(NC)C(C)C |
| InChI | InChI=1S/C7H17N/c1-5-7(8-4)6(2)3/h6-8H,5H2,1-4H3 |
| InChIKey | HJHAMSGXTLUICE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,2-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethylpentan-3-amine?
The IUPAC name of N,2-dimethylpentan-3-amine (CID 551737) is N,2-dimethylpentan-3-amine.
What is the SMILES notation for N,2-dimethylpentan-3-amine?
The canonical SMILES for N,2-dimethylpentan-3-amine is CCC(NC)C(C)C.
What is the InChIKey of N,2-dimethylpentan-3-amine?
The InChIKey is HJHAMSGXTLUICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N/c1-5-7(8-4)6(2)3/h6-8H,5H2,1-4H3.
What are the key properties of N,2-dimethylpentan-3-amine?
N,2-dimethylpentan-3-amine has a molecular weight of 115.22 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethylpentan-3-amine is sourced from PubChem (CID 551737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).