About 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide
2-(diethylaminomethyl)-N,N-diethylprop-2-enamide (PubChem CID 551739) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide.
Molecular Properties
| Compound Name | 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide |
| PubChem CID | 551739 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide |
| SMILES | C=C(CN(CC)CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C12H24N2O/c1-6-13(7-2)10-11(5)12(15)14(8-3)9-4/h5-10H2,1-4H3 |
| InChIKey | QSKOBGPJENKNLO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide?
The IUPAC name of 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide (CID 551739) is 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide.
What is the SMILES notation for 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide?
The canonical SMILES for 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide is C=C(CN(CC)CC)C(=O)N(CC)CC.
What is the InChIKey of 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide?
The InChIKey is QSKOBGPJENKNLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-6-13(7-2)10-11(5)12(15)14(8-3)9-4/h5-10H2,1-4H3.
What are the key properties of 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide?
2-(diethylaminomethyl)-N,N-diethylprop-2-enamide has a molecular weight of 212.34 g/mol, XLogP of 1.75, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylaminomethyl)-N,N-diethylprop-2-enamide is sourced from PubChem (CID 551739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).