C11H12Cl2F3NO — CID 55174172
1-(2,5-dichlorophenyl)-2-(3,3,3-trifluoropropylamino)ethanol (PubChem CID 55174172) has the molecular formula C11H12Cl2F3NO and a molecular weight of 302.12 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(3,3,3-trifluoropropylamino)ethanol.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(3,3,3-trifluoropropylamino)ethanol |
|---|---|
| PubChem CID | 55174172 |
| Molecular Formula | C11H12Cl2F3NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(3,3,3-trifluoropropylamino)ethanol |
| SMILES | OC(CNCCC(F)(F)F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H12Cl2F3NO/c12-7-1-2-9(13)8(5-7)10(18)6-17-4-3-11(14,15)16/h1-2,5,10,17-18H,3-4,6H2 |
| InChIKey | CCJILZDERKRUSL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|