C14H23ClN4 — CID 55174807
5-chloro-6-[[methyl-[(1-methylpiperidin-4-yl)methyl]amino]methyl]pyridin-2-amine (PubChem CID 55174807) has the molecular formula C14H23ClN4 and a molecular weight of 282.82 g/mol. Its IUPAC name is 5-chloro-6-[[methyl-[(1-methylpiperidin-4-yl)methyl]amino]methyl]pyridin-2-amine.
| Compound Name | 5-chloro-6-[[methyl-[(1-methylpiperidin-4-yl)methyl]amino]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 55174807 |
| Molecular Formula | C14H23ClN4 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 5-chloro-6-[[methyl-[(1-methylpiperidin-4-yl)methyl]amino]methyl]pyridin-2-amine |
| SMILES | CN1CCC(CN(C)Cc2nc(N)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H23ClN4/c1-18-7-5-11(6-8-18)9-19(2)10-13-12(15)3-4-14(16)17-13/h3-4,11H,5-10H2,1-2H3,(H2,16,17) |
| InChIKey | UBZKYEJDSMQJJQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |