About 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide
3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide (PubChem CID 55175699) has the molecular formula C11H19N5O
and a molecular weight of 237.31 g/mol. Its IUPAC name is 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide |
| PubChem CID | 55175699 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide |
| SMILES | Cc1cc(N(C)C(C)C/C(N)=N/O)nc(C)n1 |
| InChI | InChI=1S/C11H19N5O/c1-7-5-11(14-9(3)13-7)16(4)8(2)6-10(12)15-17/h5,8,17H,6H2,1-4H3,(H2,12,15) |
| InChIKey | NKMVNYCOCRCARC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide?
The IUPAC name of 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide (CID 55175699) is 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide.
What is the SMILES notation for 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide?
The canonical SMILES for 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide is Cc1cc(N(C)C(C)C/C(N)=N/O)nc(C)n1.
What is the InChIKey of 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide?
The InChIKey is NKMVNYCOCRCARC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O/c1-7-5-11(14-9(3)13-7)16(4)8(2)6-10(12)15-17/h5,8,17H,6H2,1-4H3,(H2,12,15).
What are the key properties of 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide?
3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide has a molecular weight of 237.31 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dimethylpyrimidin-4-yl)-methylamino]-N'-hydroxybutanimidamide is sourced from PubChem (CID 55175699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).