C9H10ClF3N2OS — CID 55175924
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3,3,3-trifluoropropyl)acetamide (PubChem CID 55175924) has the molecular formula C9H10ClF3N2OS and a molecular weight of 286.71 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3,3,3-trifluoropropyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3,3,3-trifluoropropyl)acetamide |
|---|---|
| PubChem CID | 55175924 |
| Molecular Formula | C9H10ClF3N2OS |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3,3,3-trifluoropropyl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)NCCC(F)(F)F |
| InChI | InChI=1S/C9H10ClF3N2OS/c10-4-6-5-17-8(15-6)3-7(16)14-2-1-9(11,12)13/h5H,1-4H2,(H,14,16) |
| InChIKey | UGGGLVQDZIPTDG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|