C12H24N4O2 — CID 55177070
[4-(2-hydroxyethyl)piperazin-1-yl]-(5-methylpiperazin-2-yl)methanone (PubChem CID 55177070) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is [4-(2-hydroxyethyl)piperazin-1-yl]-(5-methylpiperazin-2-yl)methanone.
| Compound Name | [4-(2-hydroxyethyl)piperazin-1-yl]-(5-methylpiperazin-2-yl)methanone |
|---|---|
| PubChem CID | 55177070 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | [4-(2-hydroxyethyl)piperazin-1-yl]-(5-methylpiperazin-2-yl)methanone |
| SMILES | CC1CNC(C(=O)N2CCN(CCO)CC2)CN1 |
| InChI | InChI=1S/C12H24N4O2/c1-10-8-14-11(9-13-10)12(18)16-4-2-15(3-5-16)6-7-17/h10-11,13-14,17H,2-9H2,1H3 |
| InChIKey | XLILMFBTYOEBNJ-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |