C13H25N5 — CID 55178060
2-methyl-N-[[2-(4-methylpiperazin-1-yl)-1H-imidazol-5-yl]methyl]propan-1-amine (PubChem CID 55178060) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is 2-methyl-N-[[2-(4-methylpiperazin-1-yl)-1H-imidazol-5-yl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[2-(4-methylpiperazin-1-yl)-1H-imidazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 55178060 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 2-methyl-N-[[2-(4-methylpiperazin-1-yl)-1H-imidazol-5-yl]methyl]propan-1-amine |
| SMILES | CC(C)CNCc1cnc(N2CCN(C)CC2)[nH]1 |
| InChI | InChI=1S/C13H25N5/c1-11(2)8-14-9-12-10-15-13(16-12)18-6-4-17(3)5-7-18/h10-11,14H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | FTQGZXFHJDGCSB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |