About (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate
(1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate (PubChem CID 55179230) has the molecular formula C13H16Br2N2O2
and a molecular weight of 392.09 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate |
| PubChem CID | 55179230 |
| Molecular Formula | C13H16Br2N2O2 |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate |
| SMILES | CN1CCC(OC(=O)c2cc(Br)cc(Br)c2N)CC1 |
| InChI | InChI=1S/C13H16Br2N2O2/c1-17-4-2-9(3-5-17)19-13(18)10-6-8(14)7-11(15)12(10)16/h6-7,9H,2-5,16H2,1H3 |
| InChIKey | XYZKYXYCAFPUAN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate?
The IUPAC name of (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate (CID 55179230) is (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate?
The canonical SMILES for (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate is CN1CCC(OC(=O)c2cc(Br)cc(Br)c2N)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate?
The InChIKey is XYZKYXYCAFPUAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Br2N2O2/c1-17-4-2-9(3-5-17)19-13(18)10-6-8(14)7-11(15)12(10)16/h6-7,9H,2-5,16H2,1H3.
What are the key properties of (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate?
(1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate has a molecular weight of 392.09 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 2-amino-3,5-dibromobenzoate is sourced from PubChem (CID 55179230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).