C12H14F6N4O — CID 551794
3-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]-1,1-dimethylurea (PubChem CID 551794) has the molecular formula C12H14F6N4O and a molecular weight of 344.26 g/mol. Its IUPAC name is 3-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]-1,1-dimethylurea.
| Compound Name | 3-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 551794 |
| Molecular Formula | C12H14F6N4O |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 3-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]-1,1-dimethylurea |
| SMILES | Cc1cccc(NC(NC(=O)N(C)C)(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C12H14F6N4O/c1-7-5-4-6-8(19-7)20-10(11(13,14)15,12(16,17)18)21-9(23)22(2)3/h4-6H,1-3H3,(H,19,20)(H,21,23) |
| InChIKey | IDDRLENMMZEXOM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|