About 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide
4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide (PubChem CID 55180229) has the molecular formula C13H9ClF2N2S
and a molecular weight of 298.75 g/mol. Its IUPAC name is 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide |
| PubChem CID | 55180229 |
| Molecular Formula | C13H9ClF2N2S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cl)cc1Sc1cc(F)ccc1F |
| InChI | InChI=1S/C13H9ClF2N2S/c14-7-1-3-9(13(17)18)11(5-7)19-12-6-8(15)2-4-10(12)16/h1-6H,(H3,17,18) |
| InChIKey | BLRKSWIWPWEJHY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide?
The IUPAC name of 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide (CID 55180229) is 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide.
What is the SMILES notation for 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide?
The canonical SMILES for 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide is [H]/N=C(\N)c1ccc(Cl)cc1Sc1cc(F)ccc1F.
What is the InChIKey of 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide?
The InChIKey is BLRKSWIWPWEJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClF2N2S/c14-7-1-3-9(13(17)18)11(5-7)19-12-6-8(15)2-4-10(12)16/h1-6H,(H3,17,18).
What are the key properties of 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide?
4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide has a molecular weight of 298.75 g/mol, XLogP of 4.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,5-difluorophenyl)sulfanylbenzenecarboximidamide is sourced from PubChem (CID 55180229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).